C12H17N5O2 — CID 55231877
N-(2,2-dimethoxyethyl)-4-methyl-3-(tetrazol-1-yl)aniline (PubChem CID 55231877) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-methyl-3-(tetrazol-1-yl)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-4-methyl-3-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 55231877 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-methyl-3-(tetrazol-1-yl)aniline |
| SMILES | COC(CNc1ccc(C)c(-n2cnnn2)c1)OC |
| InChI | InChI=1S/C12H17N5O2/c1-9-4-5-10(13-7-12(18-2)19-3)6-11(9)17-8-14-15-16-17/h4-6,8,12-13H,7H2,1-3H3 |
| InChIKey | BATLMQLYPBEJDB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|