C15H25N3O — CID 55232962
2-ethoxy-4-(3,3,4-trimethylpiperazin-1-yl)aniline (PubChem CID 55232962) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-ethoxy-4-(3,3,4-trimethylpiperazin-1-yl)aniline.
| Compound Name | 2-ethoxy-4-(3,3,4-trimethylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 55232962 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-ethoxy-4-(3,3,4-trimethylpiperazin-1-yl)aniline |
| SMILES | CCOc1cc(N2CCN(C)C(C)(C)C2)ccc1N |
| InChI | InChI=1S/C15H25N3O/c1-5-19-14-10-12(6-7-13(14)16)18-9-8-17(4)15(2,3)11-18/h6-7,10H,5,8-9,11,16H2,1-4H3 |
| InChIKey | LPRRRKQDHRUJRN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|