C12H26N2O3 — CID 55233466
2-(2,2-dimethoxyethylamino)-N,N,4-trimethylpentanamide (PubChem CID 55233466) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylamino)-N,N,4-trimethylpentanamide.
| Compound Name | 2-(2,2-dimethoxyethylamino)-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 55233466 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 2-(2,2-dimethoxyethylamino)-N,N,4-trimethylpentanamide |
| SMILES | COC(CNC(CC(C)C)C(=O)N(C)C)OC |
| InChI | InChI=1S/C12H26N2O3/c1-9(2)7-10(12(15)14(3)4)13-8-11(16-5)17-6/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | OQQICRBDLVSMBF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|