C10H14ClN5O2 — CID 55233676
5-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]piperidin-2-one (PubChem CID 55233676) has the molecular formula C10H14ClN5O2 and a molecular weight of 271.71 g/mol. Its IUPAC name is 5-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]piperidin-2-one.
| Compound Name | 5-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 55233676 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]piperidin-2-one |
| SMILES | CCOc1nc(Cl)nc(NC2CCC(=O)NC2)n1 |
| InChI | InChI=1S/C10H14ClN5O2/c1-2-18-10-15-8(11)14-9(16-10)13-6-3-4-7(17)12-5-6/h6H,2-5H2,1H3,(H,12,17)(H,13,14,15,16) |
| InChIKey | MKPOLELHPIKBEU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |