About 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide
2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide (PubChem CID 55233827) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide |
| PubChem CID | 55233827 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CCC(/C(N)=N/O)N(C)CC1CC2CCC1C2 |
| InChI | InChI=1S/C13H25N3O/c1-3-12(13(14)15-17)16(2)8-11-7-9-4-5-10(11)6-9/h9-12,17H,3-8H2,1-2H3,(H2,14,15) |
| InChIKey | NTAPXZMNRVMIMG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide?
The IUPAC name of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide (CID 55233827) is 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide?
The canonical SMILES for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide is CCC(/C(N)=N/O)N(C)CC1CC2CCC1C2.
What is the InChIKey of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide?
The InChIKey is NTAPXZMNRVMIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-3-12(13(14)15-17)16(2)8-11-7-9-4-5-10(11)6-9/h9-12,17H,3-8H2,1-2H3,(H2,14,15).
What are the key properties of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide?
2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide has a molecular weight of 239.36 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 55233827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).