C14H15FN2O2 — CID 55234359
4-N-(4-fluoro-2-methoxyphenyl)-2-methoxybenzene-1,4-diamine (PubChem CID 55234359) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-N-(4-fluoro-2-methoxyphenyl)-2-methoxybenzene-1,4-diamine.
| Compound Name | 4-N-(4-fluoro-2-methoxyphenyl)-2-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 55234359 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-N-(4-fluoro-2-methoxyphenyl)-2-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(Nc2ccc(F)cc2OC)ccc1N |
| InChI | InChI=1S/C14H15FN2O2/c1-18-13-8-10(4-5-11(13)16)17-12-6-3-9(15)7-14(12)19-2/h3-8,17H,16H2,1-2H3 |
| InChIKey | OYIGSGBVTNKZIP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|