C12H17NO3S — CID 55235910
2-cyclopropyl-3-pent-4-enoyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 55235910) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-cyclopropyl-3-pent-4-enoyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-cyclopropyl-3-pent-4-enoyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 55235910 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-cyclopropyl-3-pent-4-enoyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C=CCCC(=O)N1C(C(=O)O)CSC1C1CC1 |
| InChI | InChI=1S/C12H17NO3S/c1-2-3-4-10(14)13-9(12(15)16)7-17-11(13)8-5-6-8/h2,8-9,11H,1,3-7H2,(H,15,16) |
| InChIKey | XRUHTDWXQQXUNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|