About 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine
1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine (PubChem CID 55236034) has the molecular formula C15H23ClN2O
and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine.
Molecular Properties
| Compound Name | 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine |
| PubChem CID | 55236034 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1c(Cl)cccc1N1CCCOCC1 |
| InChI | InChI=1S/C15H23ClN2O/c1-2-12(17)11-13-14(16)5-3-6-15(13)18-7-4-9-19-10-8-18/h3,5-6,12H,2,4,7-11,17H2,1H3 |
| InChIKey | BTEBMVDZZGKGHM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine?
The IUPAC name of 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine (CID 55236034) is 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine.
What is the SMILES notation for 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine?
The canonical SMILES for 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine is CCC(N)Cc1c(Cl)cccc1N1CCCOCC1.
What is the InChIKey of 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine?
The InChIKey is BTEBMVDZZGKGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2O/c1-2-12(17)11-13-14(16)5-3-6-15(13)18-7-4-9-19-10-8-18/h3,5-6,12H,2,4,7-11,17H2,1H3.
What are the key properties of 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine?
1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine has a molecular weight of 282.81 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloro-6-(1,4-oxazepan-4-yl)phenyl]butan-2-amine is sourced from PubChem (CID 55236034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).