About 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one
3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one (PubChem CID 55236656) has the molecular formula C10H15N3O3S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one |
| PubChem CID | 55236656 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one |
| SMILES | O=c1ccncn1CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N3O3S/c14-10-1-3-11-8-13(10)5-4-12-9-2-6-17(15,16)7-9/h1,3,8-9,12H,2,4-7H2 |
| InChIKey | AOXMOLVVCWFTPS-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one?
The IUPAC name of 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one (CID 55236656) is 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one.
What is the SMILES notation for 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one?
The canonical SMILES for 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one is O=c1ccncn1CCNC1CCS(=O)(=O)C1.
What is the InChIKey of 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one?
The InChIKey is AOXMOLVVCWFTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3S/c14-10-1-3-11-8-13(10)5-4-12-9-2-6-17(15,16)7-9/h1,3,8-9,12H,2,4-7H2.
What are the key properties of 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one?
3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one has a molecular weight of 257.31 g/mol, XLogP of -0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyrimidin-4-one is sourced from PubChem (CID 55236656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).