C14H20ClNS — CID 55236818
3-chloro-8-[(5-ethylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octane (PubChem CID 55236818) has the molecular formula C14H20ClNS and a molecular weight of 269.84 g/mol. Its IUPAC name is 3-chloro-8-[(5-ethylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-chloro-8-[(5-ethylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 55236818 |
| Molecular Formula | C14H20ClNS |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-chloro-8-[(5-ethylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octane |
| SMILES | CCc1ccc(CN2C3CCC2CC(Cl)C3)s1 |
| InChI | InChI=1S/C14H20ClNS/c1-2-13-5-6-14(17-13)9-16-11-3-4-12(16)8-10(15)7-11/h5-6,10-12H,2-4,7-9H2,1H3 |
| InChIKey | IAMGBKCTQYTBAB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|