C15H20FNO2 — CID 55237798
8-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 55237798) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 8-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 55237798 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 8-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C[C@H](O)c1cc(F)ccc1N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C15H20FNO2/c1-9(18)14-6-10(16)2-5-15(14)17-11-3-4-12(17)8-13(19)7-11/h2,5-6,9,11-13,18-19H,3-4,7-8H2,1H3/t9-,11?,12?,13?/m0/s1 |
| InChIKey | SQWQKERMIRUWIL-KODGCSJUSA-N |
| XLogP | 2.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |