About [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol
[4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol (PubChem CID 55237968) has the molecular formula C11H11FN4OS
and a molecular weight of 266.30 g/mol. Its IUPAC name is [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol |
| PubChem CID | 55237968 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol |
| SMILES | Nc1cc(N)nc(Sc2ccc(CO)cc2F)n1 |
| InChI | InChI=1S/C11H11FN4OS/c12-7-3-6(5-17)1-2-8(7)18-11-15-9(13)4-10(14)16-11/h1-4,17H,5H2,(H4,13,14,15,16) |
| InChIKey | XNRPRSJVGJOOOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol?
The IUPAC name of [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol (CID 55237968) is [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol.
What is the SMILES notation for [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol?
The canonical SMILES for [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol is Nc1cc(N)nc(Sc2ccc(CO)cc2F)n1.
What is the InChIKey of [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol?
The InChIKey is XNRPRSJVGJOOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4OS/c12-7-3-6(5-17)1-2-8(7)18-11-15-9(13)4-10(14)16-11/h1-4,17H,5H2,(H4,13,14,15,16).
What are the key properties of [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol?
[4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol has a molecular weight of 266.30 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,6-diaminopyrimidin-2-yl)sulfanyl-3-fluorophenyl]methanol is sourced from PubChem (CID 55237968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).