C9H12F3N3O3 — CID 55238048
5-amino-1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 55238048) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 5-amino-1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55238048 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-amino-1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | Cn1cc(N)c(=O)n(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H12F3N3O3/c1-14-4-6(13)7(16)15(8(14)17)2-3-18-5-9(10,11)12/h4H,2-3,5,13H2,1H3 |
| InChIKey | GACPVNPMMYVXBT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|