C9H11F3N2O3 — CID 55238434
1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 55238434) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55238434 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCCOCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H11F3N2O3/c10-9(11,12)6-17-5-1-3-14-4-2-7(15)13-8(14)16/h2,4H,1,3,5-6H2,(H,13,15,16) |
| InChIKey | COJBFVKYFBGXLF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|