About [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine
[2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine (PubChem CID 55238883) has the molecular formula C13H11N3S2
and a molecular weight of 273.39 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine |
| PubChem CID | 55238883 |
| Molecular Formula | C13H11N3S2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine |
| SMILES | NCc1cc2ccccc2nc1Sc1nccs1 |
| InChI | InChI=1S/C13H11N3S2/c14-8-10-7-9-3-1-2-4-11(9)16-12(10)18-13-15-5-6-17-13/h1-7H,8,14H2 |
| InChIKey | BVWMUPDOIBTADE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine?
The IUPAC name of [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine (CID 55238883) is [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine.
What is the SMILES notation for [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine?
The canonical SMILES for [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine is NCc1cc2ccccc2nc1Sc1nccs1.
What is the InChIKey of [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine?
The InChIKey is BVWMUPDOIBTADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S2/c14-8-10-7-9-3-1-2-4-11(9)16-12(10)18-13-15-5-6-17-13/h1-7H,8,14H2.
What are the key properties of [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine?
[2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine has a molecular weight of 273.39 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylsulfanyl)quinolin-3-yl]methanamine is sourced from PubChem (CID 55238883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).