C11H8F2N2OS — CID 55239296
(3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methanol (PubChem CID 55239296) has the molecular formula C11H8F2N2OS and a molecular weight of 254.26 g/mol. Its IUPAC name is (3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methanol.
| Compound Name | (3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 55239296 |
| Molecular Formula | C11H8F2N2OS |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methanol |
| SMILES | OCc1cc(F)c(Sc2ccncn2)c(F)c1 |
| InChI | InChI=1S/C11H8F2N2OS/c12-8-3-7(5-16)4-9(13)11(8)17-10-1-2-14-6-15-10/h1-4,6,16H,5H2 |
| InChIKey | BGHTZQJSHXQDNJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |