About 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde
4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde (PubChem CID 55239331) has the molecular formula C13H7BrF2OS
and a molecular weight of 329.17 g/mol. Its IUPAC name is 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde.
Molecular Properties
| Compound Name | 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde |
| PubChem CID | 55239331 |
| Molecular Formula | C13H7BrF2OS |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde |
| SMILES | O=Cc1ccc(Br)cc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H7BrF2OS/c14-9-2-1-8(7-17)13(5-9)18-10-3-4-11(15)12(16)6-10/h1-7H |
| InChIKey | UACDEAVUFJMQQU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde?
The IUPAC name of 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde (CID 55239331) is 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde.
What is the SMILES notation for 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde?
The canonical SMILES for 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde is O=Cc1ccc(Br)cc1Sc1ccc(F)c(F)c1.
What is the InChIKey of 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde?
The InChIKey is UACDEAVUFJMQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrF2OS/c14-9-2-1-8(7-17)13(5-9)18-10-3-4-11(15)12(16)6-10/h1-7H.
What are the key properties of 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde?
4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde has a molecular weight of 329.17 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(3,4-difluorophenyl)sulfanylbenzaldehyde is sourced from PubChem (CID 55239331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).