C16H16BrNS — CID 55240005
N-[[4-(4-bromophenyl)sulfanylphenyl]methyl]cyclopropanamine (PubChem CID 55240005) has the molecular formula C16H16BrNS and a molecular weight of 334.28 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)sulfanylphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(4-bromophenyl)sulfanylphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 55240005 |
| Molecular Formula | C16H16BrNS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[[4-(4-bromophenyl)sulfanylphenyl]methyl]cyclopropanamine |
| SMILES | Brc1ccc(Sc2ccc(CNC3CC3)cc2)cc1 |
| InChI | InChI=1S/C16H16BrNS/c17-13-3-9-16(10-4-13)19-15-7-1-12(2-8-15)11-18-14-5-6-14/h1-4,7-10,14,18H,5-6,11H2 |
| InChIKey | XXYUPNKGWSXBHO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |