C16H17FOS — CID 55240041
(1S)-1-[4-(3,4-dimethylphenyl)sulfanyl-3-fluorophenyl]ethanol (PubChem CID 55240041) has the molecular formula C16H17FOS and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S)-1-[4-(3,4-dimethylphenyl)sulfanyl-3-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[4-(3,4-dimethylphenyl)sulfanyl-3-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 55240041 |
| Molecular Formula | C16H17FOS |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1S)-1-[4-(3,4-dimethylphenyl)sulfanyl-3-fluorophenyl]ethanol |
| SMILES | Cc1ccc(Sc2ccc([C@H](C)O)cc2F)cc1C |
| InChI | InChI=1S/C16H17FOS/c1-10-4-6-14(8-11(10)2)19-16-7-5-13(12(3)18)9-15(16)17/h4-9,12,18H,1-3H3/t12-/m0/s1 |
| InChIKey | UBAOWRDOYZQIHU-LBPRGKRZSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |