C9H11F3N2O3 — CID 55240533
1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 55240533) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is 1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55240533 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | Cn1ccc(=O)n(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11F3N2O3/c1-13-3-2-7(15)14(8(13)16)4-5-17-6-9(10,11)12/h2-3H,4-6H2,1H3 |
| InChIKey | DDJNLENPXMBZSV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|