About (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol
(1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol (PubChem CID 55240831) has the molecular formula C13H15FN2OS
and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol |
| PubChem CID | 55240831 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol |
| SMILES | Cc1cc(Sc2ccc(F)cc2[C@H](C)O)n(C)n1 |
| InChI | InChI=1S/C13H15FN2OS/c1-8-6-13(16(3)15-8)18-12-5-4-10(14)7-11(12)9(2)17/h4-7,9,17H,1-3H3/t9-/m0/s1 |
| InChIKey | JBDSMTOIGZHQDU-VIFPVBQESA-N |
| XLogP | 3.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol?
The IUPAC name of (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol (CID 55240831) is (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol.
What is the SMILES notation for (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol?
The canonical SMILES for (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol is Cc1cc(Sc2ccc(F)cc2[C@H](C)O)n(C)n1.
What is the InChIKey of (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol?
The InChIKey is JBDSMTOIGZHQDU-VIFPVBQESA-N. The full InChI is InChI=1S/C13H15FN2OS/c1-8-6-13(16(3)15-8)18-12-5-4-10(14)7-11(12)9(2)17/h4-7,9,17H,1-3H3/t9-/m0/s1.
What are the key properties of (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol?
(1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol has a molecular weight of 266.34 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-fluorophenyl]ethanol is sourced from PubChem (CID 55240831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).