C13H22N4S2 — CID 55241252
5-[2-(dicyclopropylmethylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 55241252) has the molecular formula C13H22N4S2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 5-[2-(dicyclopropylmethylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(dicyclopropylmethylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55241252 |
| Molecular Formula | C13H22N4S2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-[2-(dicyclopropylmethylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(SCCNC(C2CC2)C2CC2)s1 |
| InChI | InChI=1S/C13H22N4S2/c1-17(2)12-15-16-13(19-12)18-8-7-14-11(9-3-4-9)10-5-6-10/h9-11,14H,3-8H2,1-2H3 |
| InChIKey | GZZYFCNHJCVQMM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|