About methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate
methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate (PubChem CID 55241329) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate |
| PubChem CID | 55241329 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1c(C(N)=O)c(C)nn1C)C(C)C |
| InChI | InChI=1S/C12H20N4O3/c1-6(2)9(12(18)19-5)14-11-8(10(13)17)7(3)15-16(11)4/h6,9,14H,1-5H3,(H2,13,17) |
| InChIKey | KDMWXJNGKPTDMP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate?
The IUPAC name of methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate (CID 55241329) is methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate?
The canonical SMILES for methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate is COC(=O)C(Nc1c(C(N)=O)c(C)nn1C)C(C)C.
What is the InChIKey of methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate?
The InChIKey is KDMWXJNGKPTDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-6(2)9(12(18)19-5)14-11-8(10(13)17)7(3)15-16(11)4/h6,9,14H,1-5H3,(H2,13,17).
What are the key properties of methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate?
methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate has a molecular weight of 268.32 g/mol, XLogP of 0.44, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)amino]-3-methylbutanoate is sourced from PubChem (CID 55241329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).