About 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one
5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one (PubChem CID 55241371) has the molecular formula C12H19N3OS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one.
Molecular Properties
| Compound Name | 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one |
| PubChem CID | 55241371 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one |
| SMILES | Cc1nc(C)c(C(C)NC2CCC(=O)NC2)s1 |
| InChI | InChI=1S/C12H19N3OS/c1-7-12(17-9(3)14-7)8(2)15-10-4-5-11(16)13-6-10/h8,10,15H,4-6H2,1-3H3,(H,13,16) |
| InChIKey | JFNVJLHQDNEZGE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one?
The IUPAC name of 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one (CID 55241371) is 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one.
What is the SMILES notation for 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one?
The canonical SMILES for 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one is Cc1nc(C)c(C(C)NC2CCC(=O)NC2)s1.
What is the InChIKey of 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one?
The InChIKey is JFNVJLHQDNEZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3OS/c1-7-12(17-9(3)14-7)8(2)15-10-4-5-11(16)13-6-10/h8,10,15H,4-6H2,1-3H3,(H,13,16).
What are the key properties of 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one?
5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one has a molecular weight of 253.37 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]piperidin-2-one is sourced from PubChem (CID 55241371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).