C13H19N3O — CID 55241641
2-(oxan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 55241641) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(oxan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(oxan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 55241641 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-(oxan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Nc1nc(C2CCCOC2)nc2c1CCCC2 |
| InChI | InChI=1S/C13H19N3O/c14-12-10-5-1-2-6-11(10)15-13(16-12)9-4-3-7-17-8-9/h9H,1-8H2,(H2,14,15,16) |
| InChIKey | ZIAUBAQWMYAPOX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |