About 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid
2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid (PubChem CID 55241712) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid |
| PubChem CID | 55241712 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(c1c(C(N)=O)c(C)nn1C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H20N4O3/c1-6-16(12(3,4)11(18)19)10-8(9(13)17)7(2)14-15(10)5/h6H2,1-5H3,(H2,13,17)(H,18,19) |
| InChIKey | FDHOUMVLTJHZTA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid?
The IUPAC name of 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid (CID 55241712) is 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid?
The canonical SMILES for 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid is CCN(c1c(C(N)=O)c(C)nn1C)C(C)(C)C(=O)O.
What is the InChIKey of 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid?
The InChIKey is FDHOUMVLTJHZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-6-16(12(3,4)11(18)19)10-8(9(13)17)7(2)14-15(10)5/h6H2,1-5H3,(H2,13,17)(H,18,19).
What are the key properties of 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid?
2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid has a molecular weight of 268.32 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-carbamoyl-1,3-dimethylpyrazol-5-yl)-ethylamino]-2-methylpropanoic acid is sourced from PubChem (CID 55241712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).