C13H16F2N2O2 — CID 55241766
[2-(aminomethyl)pyrrolidin-1-yl]-[3-(difluoromethoxy)phenyl]methanone (PubChem CID 55241766) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-[3-(difluoromethoxy)phenyl]methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-[3-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 55241766 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-[3-(difluoromethoxy)phenyl]methanone |
| SMILES | NCC1CCCN1C(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-13(15)19-11-5-1-3-9(7-11)12(18)17-6-2-4-10(17)8-16/h1,3,5,7,10,13H,2,4,6,8,16H2 |
| InChIKey | FNQGGUNUBVBZKC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |