About N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine
N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine (PubChem CID 55242012) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine |
| PubChem CID | 55242012 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine |
| SMILES | NCCN(CCN1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H29N3O/c15-6-7-17(14-4-2-1-3-5-14)9-8-16-10-12-18-13-11-16/h14H,1-13,15H2 |
| InChIKey | UGQYADGHDOMJNU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine?
The IUPAC name of N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine (CID 55242012) is N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine?
The canonical SMILES for N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine is NCCN(CCN1CCOCC1)C1CCCCC1.
What is the InChIKey of N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine?
The InChIKey is UGQYADGHDOMJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O/c15-6-7-17(14-4-2-1-3-5-14)9-8-16-10-12-18-13-11-16/h14H,1-13,15H2.
What are the key properties of N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine?
N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine has a molecular weight of 255.41 g/mol, XLogP of 0.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine is sourced from PubChem (CID 55242012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).