C15H25N3O — CID 55242219
2-N,2-N-diethyl-5-N-(oxan-3-ylmethyl)pyridine-2,5-diamine (PubChem CID 55242219) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-N-(oxan-3-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 2-N,2-N-diethyl-5-N-(oxan-3-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 55242219 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-N,2-N-diethyl-5-N-(oxan-3-ylmethyl)pyridine-2,5-diamine |
| SMILES | CCN(CC)c1ccc(NCC2CCCOC2)cn1 |
| InChI | InChI=1S/C15H25N3O/c1-3-18(4-2)15-8-7-14(11-17-15)16-10-13-6-5-9-19-12-13/h7-8,11,13,16H,3-6,9-10,12H2,1-2H3 |
| InChIKey | BAIWBINSTFXXAX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |