C10H11F5N2 — CID 55242568
1-N-methyl-1-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine (PubChem CID 55242568) has the molecular formula C10H11F5N2 and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-N-methyl-1-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine.
| Compound Name | 1-N-methyl-1-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 55242568 |
| Molecular Formula | C10H11F5N2 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-N-methyl-1-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine |
| SMILES | CC(N)CN(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H11F5N2/c1-4(16)3-17(2)10-8(14)6(12)5(11)7(13)9(10)15/h4H,3,16H2,1-2H3 |
| InChIKey | IRMJAGZCCQPZGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|