About 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile
4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile (PubChem CID 55242599) has the molecular formula C12H21N5S2
and a molecular weight of 299.47 g/mol. Its IUPAC name is 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile.
Molecular Properties
| Compound Name | 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile |
| PubChem CID | 55242599 |
| Molecular Formula | C12H21N5S2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile |
| SMILES | CC(C)NC(C)(C#N)CCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C12H21N5S2/c1-9(2)14-12(3,8-13)6-7-18-11-16-15-10(19-11)17(4)5/h9,14H,6-7H2,1-5H3 |
| InChIKey | DMHJXJHNLRAWPX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile?
The IUPAC name of 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile (CID 55242599) is 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile.
What is the SMILES notation for 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile?
The canonical SMILES for 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile is CC(C)NC(C)(C#N)CCSc1nnc(N(C)C)s1.
What is the InChIKey of 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile?
The InChIKey is DMHJXJHNLRAWPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5S2/c1-9(2)14-12(3,8-13)6-7-18-11-16-15-10(19-11)17(4)5/h9,14H,6-7H2,1-5H3.
What are the key properties of 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile?
4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile has a molecular weight of 299.47 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)butanenitrile is sourced from PubChem (CID 55242599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).