About 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile
1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile (PubChem CID 55242702) has the molecular formula C10H14N4OS
and a molecular weight of 238.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile |
| PubChem CID | 55242702 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(N2CCS(=O)CC2)c1C#N |
| InChI | InChI=1S/C10H14N4OS/c1-8-9(7-11)10(13(2)12-8)14-3-5-16(15)6-4-14/h3-6H2,1-2H3 |
| InChIKey | QXAWXVATNQLHEN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile?
The IUPAC name of 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile (CID 55242702) is 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile.
What is the SMILES notation for 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile?
The canonical SMILES for 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile is Cc1nn(C)c(N2CCS(=O)CC2)c1C#N.
What is the InChIKey of 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile?
The InChIKey is QXAWXVATNQLHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4OS/c1-8-9(7-11)10(13(2)12-8)14-3-5-16(15)6-4-14/h3-6H2,1-2H3.
What are the key properties of 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile?
1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile has a molecular weight of 238.32 g/mol, XLogP of 0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-(1-oxo-1,4-thiazinan-4-yl)pyrazole-4-carbonitrile is sourced from PubChem (CID 55242702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).