C9H13F3N2O3 — CID 55243253
5-(diethoxymethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole (PubChem CID 55243253) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55243253 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(diethoxymethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(CC(F)(F)F)no1 |
| InChI | InChI=1S/C9H13F3N2O3/c1-3-15-8(16-4-2)7-13-6(14-17-7)5-9(10,11)12/h8H,3-5H2,1-2H3 |
| InChIKey | MECOPYRGGXFUIK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|