C15H21NO2S — CID 55243395
3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]oxane-3-carbaldehyde (PubChem CID 55243395) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is 3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]oxane-3-carbaldehyde.
| Compound Name | 3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]oxane-3-carbaldehyde |
|---|---|
| PubChem CID | 55243395 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]oxane-3-carbaldehyde |
| SMILES | CC1c2ccsc2CCN1CC1(C=O)CCCOC1 |
| InChI | InChI=1S/C15H21NO2S/c1-12-13-4-8-19-14(13)3-6-16(12)9-15(10-17)5-2-7-18-11-15/h4,8,10,12H,2-3,5-7,9,11H2,1H3 |
| InChIKey | KQWZKGCIJDNLGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|