About 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine
3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine (PubChem CID 55243747) has the molecular formula C12H17Cl2N3
and a molecular weight of 274.19 g/mol. Its IUPAC name is 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine |
| PubChem CID | 55243747 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine |
| SMILES | NCCCC1CCCN1c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N3/c13-9-7-11(14)12(16-8-9)17-6-2-4-10(17)3-1-5-15/h7-8,10H,1-6,15H2 |
| InChIKey | TZYGOEKTOUYRON-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine?
The IUPAC name of 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine (CID 55243747) is 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine.
What is the SMILES notation for 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine?
The canonical SMILES for 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine is NCCCC1CCCN1c1ncc(Cl)cc1Cl.
What is the InChIKey of 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine?
The InChIKey is TZYGOEKTOUYRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2N3/c13-9-7-11(14)12(16-8-9)17-6-2-4-10(17)3-1-5-15/h7-8,10H,1-6,15H2.
What are the key properties of 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine?
3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine has a molecular weight of 274.19 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,5-dichloro-2-pyridinyl)pyrrolidin-2-yl]propan-1-amine is sourced from PubChem (CID 55243747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).