C11H16F3N5 — CID 55243879
5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 55243879) has the molecular formula C11H16F3N5 and a molecular weight of 275.28 g/mol. Its IUPAC name is 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 55243879 |
| Molecular Formula | C11H16F3N5 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H16F3N5/c1-6-8(9(15)16)10(18(2)17-6)19(7-3-4-7)5-11(12,13)14/h7H,3-5H2,1-2H3,(H3,15,16) |
| InChIKey | ZLBQKUYJPHTVPY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|