C15H23N3 — CID 55244166
2-[1-(2-methylpentyl)benzimidazol-2-yl]ethanamine (PubChem CID 55244166) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-[1-(2-methylpentyl)benzimidazol-2-yl]ethanamine.
| Compound Name | 2-[1-(2-methylpentyl)benzimidazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 55244166 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2-[1-(2-methylpentyl)benzimidazol-2-yl]ethanamine |
| SMILES | CCCC(C)Cn1c(CCN)nc2ccccc21 |
| InChI | InChI=1S/C15H23N3/c1-3-6-12(2)11-18-14-8-5-4-7-13(14)17-15(18)9-10-16/h4-5,7-8,12H,3,6,9-11,16H2,1-2H3 |
| InChIKey | KZLPKXQCVDEYPY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |