C11H7ClN2O4 — CID 55244586
4-[(5-chlorofuran-2-carbonyl)amino]pyridine-2-carboxylic acid (PubChem CID 55244586) has the molecular formula C11H7ClN2O4 and a molecular weight of 266.64 g/mol. Its IUPAC name is 4-[(5-chlorofuran-2-carbonyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(5-chlorofuran-2-carbonyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 55244586 |
| Molecular Formula | C11H7ClN2O4 |
| Molecular Weight | 266.64 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 4-[(5-chlorofuran-2-carbonyl)amino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccc(Cl)o2)ccn1 |
| InChI | InChI=1S/C11H7ClN2O4/c12-9-2-1-8(18-9)10(15)14-6-3-4-13-7(5-6)11(16)17/h1-5H,(H,16,17)(H,13,14,15) |
| InChIKey | QUQIIYAUQAURKD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |