About 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide
1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide (PubChem CID 55244865) has the molecular formula C10H11ClN2O2S2
and a molecular weight of 290.80 g/mol. Its IUPAC name is 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide |
| PubChem CID | 55244865 |
| Molecular Formula | C10H11ClN2O2S2 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide |
| SMILES | Cc1cc(C)c2nc(NS(=O)(=O)CCl)sc2c1 |
| InChI | InChI=1S/C10H11ClN2O2S2/c1-6-3-7(2)9-8(4-6)16-10(12-9)13-17(14,15)5-11/h3-4H,5H2,1-2H3,(H,12,13) |
| InChIKey | FMMVYOMXRGEGFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide?
The IUPAC name of 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide (CID 55244865) is 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide.
What is the SMILES notation for 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide?
The canonical SMILES for 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide is Cc1cc(C)c2nc(NS(=O)(=O)CCl)sc2c1.
What is the InChIKey of 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide?
The InChIKey is FMMVYOMXRGEGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O2S2/c1-6-3-7(2)9-8(4-6)16-10(12-9)13-17(14,15)5-11/h3-4H,5H2,1-2H3,(H,12,13).
What are the key properties of 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide?
1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide has a molecular weight of 290.80 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)methanesulfonamide is sourced from PubChem (CID 55244865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).