About bis(trimethylsilyl) 2,2,3-trimethylpentanedioate
bis(trimethylsilyl) 2,2,3-trimethylpentanedioate (PubChem CID 552453) has the molecular formula C14H30O4Si2
and a molecular weight of 318.56 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,2,3-trimethylpentanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) 2,2,3-trimethylpentanedioate |
| PubChem CID | 552453 |
| Molecular Formula | C14H30O4Si2 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | bis(trimethylsilyl) 2,2,3-trimethylpentanedioate |
| SMILES | CC(CC(=O)O[Si](C)(C)C)C(C)(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H30O4Si2/c1-11(10-12(15)17-19(4,5)6)14(2,3)13(16)18-20(7,8)9/h11H,10H2,1-9H3 |
| InChIKey | FCGMILWDOUYMRY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) 2,2,3-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) 2,2,3-trimethylpentanedioate?
The IUPAC name of bis(trimethylsilyl) 2,2,3-trimethylpentanedioate (CID 552453) is bis(trimethylsilyl) 2,2,3-trimethylpentanedioate.
What is the SMILES notation for bis(trimethylsilyl) 2,2,3-trimethylpentanedioate?
The canonical SMILES for bis(trimethylsilyl) 2,2,3-trimethylpentanedioate is CC(CC(=O)O[Si](C)(C)C)C(C)(C)C(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) 2,2,3-trimethylpentanedioate?
The InChIKey is FCGMILWDOUYMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4Si2/c1-11(10-12(15)17-19(4,5)6)14(2,3)13(16)18-20(7,8)9/h11H,10H2,1-9H3.
What are the key properties of bis(trimethylsilyl) 2,2,3-trimethylpentanedioate?
bis(trimethylsilyl) 2,2,3-trimethylpentanedioate has a molecular weight of 318.56 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) 2,2,3-trimethylpentanedioate is sourced from PubChem (CID 552453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).