C8H12ClN3O4S — CID 55246021
8-(chloromethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 55246021) has the molecular formula C8H12ClN3O4S and a molecular weight of 281.72 g/mol. Its IUPAC name is 8-(chloromethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(chloromethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55246021 |
| Molecular Formula | C8H12ClN3O4S |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 8-(chloromethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(S(=O)(=O)CCl)CC2)N1 |
| InChI | InChI=1S/C8H12ClN3O4S/c9-5-17(15,16)12-3-1-8(2-4-12)6(13)10-7(14)11-8/h1-5H2,(H2,10,11,13,14) |
| InChIKey | ZVILHQVAOPWHCV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|