C11H8N4O3S — CID 55246477
3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 55246477) has the molecular formula C11H8N4O3S and a molecular weight of 276.28 g/mol. Its IUPAC name is 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 55246477 |
| Molecular Formula | C11H8N4O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1Cn1nnc(-c2ccco2)n1 |
| InChI | InChI=1S/C11H8N4O3S/c16-11(17)9-7(3-5-19-9)6-15-13-10(12-14-15)8-2-1-4-18-8/h1-5H,6H2,(H,16,17) |
| InChIKey | YBKQSUAWIVNFRI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |