C13H22N4OS — CID 55247550
2-(ethylamino)-2-methyl-6-pyrazin-2-ylsulfanylhexanamide (PubChem CID 55247550) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-6-pyrazin-2-ylsulfanylhexanamide.
| Compound Name | 2-(ethylamino)-2-methyl-6-pyrazin-2-ylsulfanylhexanamide |
|---|---|
| PubChem CID | 55247550 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(ethylamino)-2-methyl-6-pyrazin-2-ylsulfanylhexanamide |
| SMILES | CCNC(C)(CCCCSc1cnccn1)C(N)=O |
| InChI | InChI=1S/C13H22N4OS/c1-3-17-13(2,12(14)18)6-4-5-9-19-11-10-15-7-8-16-11/h7-8,10,17H,3-6,9H2,1-2H3,(H2,14,18) |
| InChIKey | HJZAYKULIAXPSM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|