C12H10N2O4S — CID 55248378
5-methyl-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 55248378) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 5-methyl-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 5-methyl-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 55248378 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-methyl-2-[(6-oxo-1H-pyridine-3-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(NC(=O)c2ccc(=O)[nH]c2)s1 |
| InChI | InChI=1S/C12H10N2O4S/c1-6-4-8(12(17)18)11(19-6)14-10(16)7-2-3-9(15)13-5-7/h2-5H,1H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | RNRYITIOKMEIQO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |