C15H22BrN — CID 55248454
6-bromo-N-pentyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 55248454) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 6-bromo-N-pentyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-pentyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 55248454 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 6-bromo-N-pentyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCCNC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C15H22BrN/c1-2-3-4-9-17-15-8-6-12-10-14(16)7-5-13(12)11-15/h5,7,10,15,17H,2-4,6,8-9,11H2,1H3 |
| InChIKey | VGRDLEQIFQXFOY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|