About 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene
4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene (PubChem CID 55248980) has the molecular formula C12H16F2O2S
and a molecular weight of 262.32 g/mol. Its IUPAC name is 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene |
| PubChem CID | 55248980 |
| Molecular Formula | C12H16F2O2S |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene |
| SMILES | CCOC(CSc1ccc(F)c(F)c1)OCC |
| InChI | InChI=1S/C12H16F2O2S/c1-3-15-12(16-4-2)8-17-9-5-6-10(13)11(14)7-9/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | JUWOARFOSJNXPW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene?
The IUPAC name of 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene (CID 55248980) is 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene is CCOC(CSc1ccc(F)c(F)c1)OCC.
What is the InChIKey of 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene?
The InChIKey is JUWOARFOSJNXPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O2S/c1-3-15-12(16-4-2)8-17-9-5-6-10(13)11(14)7-9/h5-7,12H,3-4,8H2,1-2H3.
What are the key properties of 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene?
4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene has a molecular weight of 262.32 g/mol, XLogP of 3.46, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-diethoxyethylsulfanyl)-1,2-difluorobenzene is sourced from PubChem (CID 55248980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).