C15H21NO2 — CID 55249362
1-(2,2-diethoxyethyl)-6-methylindole (PubChem CID 55249362) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-6-methylindole.
| Compound Name | 1-(2,2-diethoxyethyl)-6-methylindole |
|---|---|
| PubChem CID | 55249362 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-6-methylindole |
| SMILES | CCOC(Cn1ccc2ccc(C)cc21)OCC |
| InChI | InChI=1S/C15H21NO2/c1-4-17-15(18-5-2)11-16-9-8-13-7-6-12(3)10-14(13)16/h6-10,15H,4-5,11H2,1-3H3 |
| InChIKey | JEKMBNXIBDDOSV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|