About 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide
2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide (PubChem CID 55249624) has the molecular formula C10H19N3O2S2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide.
Molecular Properties
| Compound Name | 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide |
| PubChem CID | 55249624 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCC(N2CCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C10H19N3O2S2/c11-10(16)8-12-5-2-9(3-6-12)13-4-1-7-17(13,14)15/h9H,1-8H2,(H2,11,16) |
| InChIKey | NMISTCBAFYWUJK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide?
The IUPAC name of 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide (CID 55249624) is 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide.
What is the SMILES notation for 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide?
The canonical SMILES for 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide is NC(=S)CN1CCC(N2CCCS2(=O)=O)CC1.
What is the InChIKey of 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide?
The InChIKey is NMISTCBAFYWUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2S2/c11-10(16)8-12-5-2-9(3-6-12)13-4-1-7-17(13,14)15/h9H,1-8H2,(H2,11,16).
What are the key properties of 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide?
2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide has a molecular weight of 277.41 g/mol, XLogP of -0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)piperidin-1-yl]ethanethioamide is sourced from PubChem (CID 55249624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).