About ethyl 2-(aminomethyl)hexanoate
ethyl 2-(aminomethyl)hexanoate (PubChem CID 55250485) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)hexanoate.
Molecular Properties
| Compound Name | ethyl 2-(aminomethyl)hexanoate |
| PubChem CID | 55250485 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | ethyl 2-(aminomethyl)hexanoate |
| SMILES | CCCCC(CN)C(=O)OCC |
| InChI | InChI=1S/C9H19NO2/c1-3-5-6-8(7-10)9(11)12-4-2/h8H,3-7,10H2,1-2H3 |
| InChIKey | WAOJEHBDRPGNNT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(aminomethyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(aminomethyl)hexanoate?
The IUPAC name of ethyl 2-(aminomethyl)hexanoate (CID 55250485) is ethyl 2-(aminomethyl)hexanoate.
What is the SMILES notation for ethyl 2-(aminomethyl)hexanoate?
The canonical SMILES for ethyl 2-(aminomethyl)hexanoate is CCCCC(CN)C(=O)OCC.
What is the InChIKey of ethyl 2-(aminomethyl)hexanoate?
The InChIKey is WAOJEHBDRPGNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-5-6-8(7-10)9(11)12-4-2/h8H,3-7,10H2,1-2H3.
What are the key properties of ethyl 2-(aminomethyl)hexanoate?
ethyl 2-(aminomethyl)hexanoate has a molecular weight of 173.26 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(aminomethyl)hexanoate is sourced from PubChem (CID 55250485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).