C11H17N — CID 55250627
(2Z,6E)-3,7-dimethylnona-2,6-dienenitrile (PubChem CID 55250627) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2Z,6E)-3,7-dimethylnona-2,6-dienenitrile.
| Compound Name | (2Z,6E)-3,7-dimethylnona-2,6-dienenitrile |
|---|---|
| PubChem CID | 55250627 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2Z,6E)-3,7-dimethylnona-2,6-dienenitrile |
| SMILES | CC/C(C)=C/CC/C(C)=C\C#N |
| InChI | InChI=1S/C11H17N/c1-4-10(2)6-5-7-11(3)8-9-12/h6,8H,4-5,7H2,1-3H3/b10-6+,11-8- |
| InChIKey | DHJVLXVXNFUSMU-HOLFWZHHSA-N |
| XLogP | 3.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|